C18H21N5O3S — CID 10762802
N-[[5-[2-[[N'-[3-(furan-2-yl)propyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide (PubChem CID 10762802) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is N-[[5-[2-[[N'-[3-(furan-2-yl)propyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[[N'-[3-(furan-2-yl)propyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10762802 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[[5-[2-[[N'-[3-(furan-2-yl)propyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(N/C(N)=N/CCCc3ccco3)n2)o1 |
| InChI | InChI=1S/C18H21N5O3S/c1-12(24)21-10-14-6-7-16(26-14)15-11-27-18(22-15)23-17(19)20-8-2-4-13-5-3-9-25-13/h3,5-7,9,11H,2,4,8,10H2,1H3,(H,21,24)(H3,19,20,22,23) |
| InChIKey | IFLBNQYWGVVFSB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|