C17H24N4O3S — CID 119696335
N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-7-aminoheptanamide (PubChem CID 119696335) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-7-aminoheptanamide.
| Compound Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-7-aminoheptanamide |
|---|---|
| PubChem CID | 119696335 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-7-aminoheptanamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)CCCCCCN)n2)o1 |
| InChI | InChI=1S/C17H24N4O3S/c1-12(22)19-10-13-7-8-15(24-13)14-11-25-17(20-14)21-16(23)6-4-2-3-5-9-18/h7-8,11H,2-6,9-10,18H2,1H3,(H,19,22)(H,20,21,23) |
| InChIKey | JBEDDPUSGMKOHK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|