C21H22ClN3O4S — CID 24570808
N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-4-(4-chloro-2-methylphenoxy)butanamide (PubChem CID 24570808) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-4-(4-chloro-2-methylphenoxy)butanamide.
| Compound Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-4-(4-chloro-2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 24570808 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[4-[5-(acetamidomethyl)furan-2-yl]-1,3-thiazol-2-yl]-4-(4-chloro-2-methylphenoxy)butanamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)CCCOc3ccc(Cl)cc3C)n2)o1 |
| InChI | InChI=1S/C21H22ClN3O4S/c1-13-10-15(22)5-7-18(13)28-9-3-4-20(27)25-21-24-17(12-30-21)19-8-6-16(29-19)11-23-14(2)26/h5-8,10,12H,3-4,9,11H2,1-2H3,(H,23,26)(H,24,25,27) |
| InChIKey | FHZPDCVISDDKMQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|