C18H23Cl2N5O2S — CID 139729799
1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-[2-(2-methoxyphenyl)ethyl]guanidine;dihydrochloride (PubChem CID 139729799) has the molecular formula C18H23Cl2N5O2S and a molecular weight of 444.39 g/mol. Its IUPAC name is 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-[2-(2-methoxyphenyl)ethyl]guanidine;dihydrochloride.
| Compound Name | 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-[2-(2-methoxyphenyl)ethyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 139729799 |
| Molecular Formula | C18H23Cl2N5O2S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-[2-(2-methoxyphenyl)ethyl]guanidine;dihydrochloride |
| SMILES | COc1ccccc1CC/N=C(\N)Nc1nc(-c2ccc(CN)o2)cs1.Cl.Cl |
| InChI | InChI=1S/C18H21N5O2S.2ClH/c1-24-15-5-3-2-4-12(15)8-9-21-17(20)23-18-22-14(11-26-18)16-7-6-13(10-19)25-16;;/h2-7,11H,8-10,19H2,1H3,(H3,20,21,22,23);2*1H |
| InChIKey | UFUGRGNQEXGSIU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|