C22H21N5OS — CID 57205416
1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-[(2-phenylphenyl)methyl]guanidine (PubChem CID 57205416) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-[(2-phenylphenyl)methyl]guanidine.
| Compound Name | 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-[(2-phenylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 57205416 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-[(2-phenylphenyl)methyl]guanidine |
| SMILES | NCc1ccc(-c2csc(N/C(N)=N/Cc3ccccc3-c3ccccc3)n2)o1 |
| InChI | InChI=1S/C22H21N5OS/c23-12-17-10-11-20(28-17)19-14-29-22(26-19)27-21(24)25-13-16-8-4-5-9-18(16)15-6-2-1-3-7-15/h1-11,14H,12-13,23H2,(H3,24,25,26,27) |
| InChIKey | DMRRTJMCMNGNNL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|