C14H23Cl2N5OS — CID 139729789
1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-(2,2-dimethylpropyl)guanidine;dihydrochloride (PubChem CID 139729789) has the molecular formula C14H23Cl2N5OS and a molecular weight of 380.35 g/mol. Its IUPAC name is 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-(2,2-dimethylpropyl)guanidine;dihydrochloride.
| Compound Name | 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-(2,2-dimethylpropyl)guanidine;dihydrochloride |
|---|---|
| PubChem CID | 139729789 |
| Molecular Formula | C14H23Cl2N5OS |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-[4-[5-(aminomethyl)furan-2-yl]-1,3-thiazol-2-yl]-2-(2,2-dimethylpropyl)guanidine;dihydrochloride |
| SMILES | CC(C)(C)C/N=C(\N)Nc1nc(-c2ccc(CN)o2)cs1.Cl.Cl |
| InChI | InChI=1S/C14H21N5OS.2ClH/c1-14(2,3)8-17-12(16)19-13-18-10(7-21-13)11-5-4-9(6-15)20-11;;/h4-5,7H,6,8,15H2,1-3H3,(H3,16,17,18,19);2*1H |
| InChIKey | OAOOPHORFYZTPW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|