C22H21ClN4O5S — CID 161026178
but-2-enedioic acid;1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-[(2-methoxyphenyl)methyl]guanidine (PubChem CID 161026178) has the molecular formula C22H21ClN4O5S and a molecular weight of 488.95 g/mol. Its IUPAC name is but-2-enedioic acid;1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-[(2-methoxyphenyl)methyl]guanidine.
| Compound Name | but-2-enedioic acid;1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-[(2-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 161026178 |
| Molecular Formula | C22H21ClN4O5S |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | but-2-enedioic acid;1-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-[(2-methoxyphenyl)methyl]guanidine |
| SMILES | COc1ccccc1C/N=C(\N)Nc1nc(-c2ccccc2Cl)cs1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H17ClN4OS.C4H4O4/c1-24-16-9-5-2-6-12(16)10-21-17(20)23-18-22-15(11-25-18)13-7-3-4-8-14(13)19;5-3(6)1-2-4(7)8/h2-9,11H,10H2,1H3,(H3,20,21,22,23);1-2H,(H,5,6)(H,7,8) |
| InChIKey | TYZSBFPNUCJBFX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|