C29H30N6O5S2 — CID 159916837
(E)-but-2-enedioic acid;2-[(2-methoxyphenyl)methyl]-1-(6-methyl-1,3-benzothiazol-2-yl)guanidine;6-methyl-1,3-benzothiazol-2-amine (PubChem CID 159916837) has the molecular formula C29H30N6O5S2 and a molecular weight of 606.73 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[(2-methoxyphenyl)methyl]-1-(6-methyl-1,3-benzothiazol-2-yl)guanidine;6-methyl-1,3-benzothiazol-2-amine.
| Compound Name | (E)-but-2-enedioic acid;2-[(2-methoxyphenyl)methyl]-1-(6-methyl-1,3-benzothiazol-2-yl)guanidine;6-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 159916837 |
| Molecular Formula | C29H30N6O5S2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[(2-methoxyphenyl)methyl]-1-(6-methyl-1,3-benzothiazol-2-yl)guanidine;6-methyl-1,3-benzothiazol-2-amine |
| SMILES | COc1ccccc1C/N=C(\N)Nc1nc2ccc(C)cc2s1.Cc1ccc2nc(N)sc2c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H18N4OS.C8H8N2S.C4H4O4/c1-11-7-8-13-15(9-11)23-17(20-13)21-16(18)19-10-12-5-3-4-6-14(12)22-2;1-5-2-3-6-7(4-5)11-8(9)10-6;5-3(6)1-2-4(7)8/h3-9H,10H2,1-2H3,(H3,18,19,20,21);2-4H,1H3,(H2,9,10);1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | RWTPUMZDKJPNPF-WXXKFALUSA-N |
| XLogP | 5.44 |
| TPSA | 186.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|