C18H18ClN5O2S — CID 87380543
1-[4-(3-chloro-2-pyridinyl)-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine (PubChem CID 87380543) has the molecular formula C18H18ClN5O2S and a molecular weight of 403.90 g/mol. Its IUPAC name is 1-[4-(3-chloro-2-pyridinyl)-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[4-(3-chloro-2-pyridinyl)-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 87380543 |
| Molecular Formula | C18H18ClN5O2S |
| Molecular Weight | 403.90 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-[4-(3-chloro-2-pyridinyl)-1,3-thiazol-2-yl]-2-[(2,6-dimethoxyphenyl)methyl]guanidine |
| SMILES | COc1cccc(OC)c1C/N=C(\N)Nc1nc(-c2ncccc2Cl)cs1 |
| InChI | InChI=1S/C18H18ClN5O2S/c1-25-14-6-3-7-15(26-2)11(14)9-22-17(20)24-18-23-13(10-27-18)16-12(19)5-4-8-21-16/h3-8,10H,9H2,1-2H3,(H3,20,22,23,24) |
| InChIKey | NFXPEJRQLUMQHP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|