C18H27N5O4S — CID 87380709
acetic acid;2-[(2,6-dimethoxyphenyl)methyl]-1-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 87380709) has the molecular formula C18H27N5O4S and a molecular weight of 409.51 g/mol. Its IUPAC name is acetic acid;2-[(2,6-dimethoxyphenyl)methyl]-1-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | acetic acid;2-[(2,6-dimethoxyphenyl)methyl]-1-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 87380709 |
| Molecular Formula | C18H27N5O4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | acetic acid;2-[(2,6-dimethoxyphenyl)methyl]-1-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | CC(=O)O.COc1cccc(OC)c1C/N=C(\N)Nc1nc(CN(C)C)cs1 |
| InChI | InChI=1S/C16H23N5O2S.C2H4O2/c1-21(2)9-11-10-24-16(19-11)20-15(17)18-8-12-13(22-3)6-5-7-14(12)23-4;1-2(3)4/h5-7,10H,8-9H2,1-4H3,(H3,17,18,19,20);1H3,(H,3,4) |
| InChIKey | JRMRZBJLSZAQTN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|