C22H20FN5O2S — CID 67386854
2-[(2,6-dimethoxyphenyl)methyl]-1-[4-(6-fluoroquinolin-4-yl)-1,3-thiazol-2-yl]guanidine (PubChem CID 67386854) has the molecular formula C22H20FN5O2S and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenyl)methyl]-1-[4-(6-fluoroquinolin-4-yl)-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-[4-(6-fluoroquinolin-4-yl)-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 67386854 |
| Molecular Formula | C22H20FN5O2S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-[4-(6-fluoroquinolin-4-yl)-1,3-thiazol-2-yl]guanidine |
| SMILES | COc1cccc(OC)c1C/N=C(\N)Nc1nc(-c2ccnc3ccc(F)cc23)cs1 |
| InChI | InChI=1S/C22H20FN5O2S/c1-29-19-4-3-5-20(30-2)16(19)11-26-21(24)28-22-27-18(12-31-22)14-8-9-25-17-7-6-13(23)10-15(14)17/h3-10,12H,11H2,1-2H3,(H3,24,26,27,28) |
| InChIKey | OLRNUFMBQQFCDM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|