C20H23N5O3 — CID 67386782
2-[(2,6-dimethoxyphenyl)methyl]-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]guanidine (PubChem CID 67386782) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenyl)methyl]-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]guanidine.
| Compound Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]guanidine |
|---|---|
| PubChem CID | 67386782 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]guanidine |
| SMILES | COc1ccc(-c2cc(N/C(N)=N/Cc3c(OC)cccc3OC)n[nH]2)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-26-14-9-7-13(8-10-14)16-11-19(25-24-16)23-20(21)22-12-15-17(27-2)5-4-6-18(15)28-3/h4-11H,12H2,1-3H3,(H4,21,22,23,24,25) |
| InChIKey | HCWSBRZLZCRGJW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|