C21H21FN4O2 — CID 67532325
2-[(2,6-dimethoxyphenyl)methyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]guanidine (PubChem CID 67532325) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenyl)methyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]guanidine.
| Compound Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]guanidine |
|---|---|
| PubChem CID | 67532325 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[(2,6-dimethoxyphenyl)methyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]guanidine |
| SMILES | COc1cccc(OC)c1C/N=C(\N)Nc1ccc(-c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C21H21FN4O2/c1-27-18-4-3-5-19(28-2)17(18)13-25-21(23)26-20-11-8-15(12-24-20)14-6-9-16(22)10-7-14/h3-12H,13H2,1-2H3,(H3,23,24,25,26) |
| InChIKey | FCXNPVQRUNRZPH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|