C12H15N5O — CID 103643251
2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-1-phenylguanidine (PubChem CID 103643251) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-1-phenylguanidine.
| Compound Name | 2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 103643251 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-1-phenylguanidine |
| SMILES | Cc1noc(CC/N=C(\N)Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H15N5O/c1-9-15-11(18-17-9)7-8-14-12(13)16-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H3,13,14,16) |
| InChIKey | BCDPJLMJVCGTML-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|