C19H22IN5O — CID 110935533
2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-1-phenylguanidine;hydroiodide (PubChem CID 110935533) has the molecular formula C19H22IN5O and a molecular weight of 463.32 g/mol. Its IUPAC name is 2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110935533 |
| Molecular Formula | C19H22IN5O |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-1-phenylguanidine;hydroiodide |
| SMILES | CCc1noc(-c2ccc(CC/N=C(\N)Nc3ccccc3)cc2)n1.I |
| InChI | InChI=1S/C19H21N5O.HI/c1-2-17-23-18(25-24-17)15-10-8-14(9-11-15)12-13-21-19(20)22-16-6-4-3-5-7-16;/h3-11H,2,12-13H2,1H3,(H3,20,21,22);1H |
| InChIKey | QOLRPJACFXHXLH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|