C10H10N2O — CID 20678688
3-ethyl-5-phenyl-1,2,4-oxadiazole (PubChem CID 20678688) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-ethyl-5-phenyl-1,2,4-oxadiazole.
| Compound Name | 3-ethyl-5-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 20678688 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3-ethyl-5-phenyl-1,2,4-oxadiazole |
| SMILES | CCc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H10N2O/c1-2-9-11-10(13-12-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | JUESKIQSLQZEHC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |