C10H10N2O3 — CID 136904389
4-(3-ethyl-1,2,4-oxadiazol-5-yl)benzene-1,2-diol (PubChem CID 136904389) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 4-(3-ethyl-1,2,4-oxadiazol-5-yl)benzene-1,2-diol.
| Compound Name | 4-(3-ethyl-1,2,4-oxadiazol-5-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 136904389 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 4-(3-ethyl-1,2,4-oxadiazol-5-yl)benzene-1,2-diol |
| SMILES | CCc1noc(-c2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C10H10N2O3/c1-2-9-11-10(15-12-9)6-3-4-7(13)8(14)5-6/h3-5,13-14H,2H2,1H3 |
| InChIKey | RTLQGXGPFFLUNG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|