C10H10N2O2 — CID 59009688
3-(methoxymethyl)-5-phenyl-1,2,4-oxadiazole (PubChem CID 59009688) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-(methoxymethyl)-5-phenyl-1,2,4-oxadiazole.
| Compound Name | 3-(methoxymethyl)-5-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 59009688 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-(methoxymethyl)-5-phenyl-1,2,4-oxadiazole |
| SMILES | COCc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H10N2O2/c1-13-7-9-11-10(14-12-9)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | GUDYXQFZIMAQHQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |