C13H18IN5O — CID 110935521
2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 110935521) has the molecular formula C13H18IN5O and a molecular weight of 387.23 g/mol. Its IUPAC name is 2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110935521 |
| Molecular Formula | C13H18IN5O |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 2-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCc1noc(-c2ccc(CCN=C(N)N)cc2)n1.I |
| InChI | InChI=1S/C13H17N5O.HI/c1-2-11-17-12(19-18-11)10-5-3-9(4-6-10)7-8-16-13(14)15;/h3-6H,2,7-8H2,1H3,(H4,14,15,16);1H |
| InChIKey | KXXISBCUFUDFNO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|