C11H13N5O — CID 106401269
2-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1-phenylguanidine (PubChem CID 106401269) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 2-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1-phenylguanidine.
| Compound Name | 2-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 106401269 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1-phenylguanidine |
| SMILES | N/C(=N\CCc1ncon1)Nc1ccccc1 |
| InChI | InChI=1S/C11H13N5O/c12-11(15-9-4-2-1-3-5-9)13-7-6-10-14-8-17-16-10/h1-5,8H,6-7H2,(H3,12,13,15) |
| InChIKey | SPTBPRSIFDFUNN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|