C13H18IN5O — CID 111076132
1-(3,4-dimethylphenyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111076132) has the molecular formula C13H18IN5O and a molecular weight of 387.23 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111076132 |
| Molecular Formula | C13H18IN5O |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1noc(C/N=C(\N)Nc2ccc(C)c(C)c2)n1.I |
| InChI | InChI=1S/C13H17N5O.HI/c1-8-4-5-11(6-9(8)2)17-13(14)15-7-12-16-10(3)18-19-12;/h4-6H,7H2,1-3H3,(H3,14,15,17);1H |
| InChIKey | RHCXSGHRDVFTFA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|