C16H20IN3O — CID 111045947
1-(3,4-dimethylphenyl)-2-[(3-hydroxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111045947) has the molecular formula C16H20IN3O and a molecular weight of 397.26 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[(3-hydroxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[(3-hydroxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111045947 |
| Molecular Formula | C16H20IN3O |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[(3-hydroxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/Cc2cccc(O)c2)cc1C.I |
| InChI | InChI=1S/C16H19N3O.HI/c1-11-6-7-14(8-12(11)2)19-16(17)18-10-13-4-3-5-15(20)9-13;/h3-9,20H,10H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | IMOAGJXFEVEWNI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|