C15H20IN5 — CID 119119933
1-(3,4-dimethylphenyl)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 119119933) has the molecular formula C15H20IN5 and a molecular weight of 397.26 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119119933 |
| Molecular Formula | C15H20IN5 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1nccc(C/N=C(\N)Nc2ccc(C)c(C)c2)n1.I |
| InChI | InChI=1S/C15H19N5.HI/c1-10-4-5-13(8-11(10)2)20-15(16)18-9-14-6-7-17-12(3)19-14;/h4-8H,9H2,1-3H3,(H3,16,18,20);1H |
| InChIKey | NNXDVCXCWGMVDK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|