C16H17F3N4 — CID 122097136
1-(3,4-dimethylphenyl)-2-[[6-(trifluoromethyl)-2-pyridinyl]methyl]guanidine (PubChem CID 122097136) has the molecular formula C16H17F3N4 and a molecular weight of 322.33 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[[6-(trifluoromethyl)-2-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[[6-(trifluoromethyl)-2-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 122097136 |
| Molecular Formula | C16H17F3N4 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[[6-(trifluoromethyl)-2-pyridinyl]methyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2cccc(C(F)(F)F)n2)cc1C |
| InChI | InChI=1S/C16H17F3N4/c1-10-6-7-12(8-11(10)2)23-15(20)21-9-13-4-3-5-14(22-13)16(17,18)19/h3-8H,9H2,1-2H3,(H3,20,21,23) |
| InChIKey | LIAAQPZZXJFYAK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|