C15H21N5S — CID 111600829
2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-(3,4-dimethylphenyl)guanidine (PubChem CID 111600829) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111600829 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-(3,4-dimethylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2csc(N(C)C)n2)cc1C |
| InChI | InChI=1S/C15H21N5S/c1-10-5-6-12(7-11(10)2)18-14(16)17-8-13-9-21-15(19-13)20(3)4/h5-7,9H,8H2,1-4H3,(H3,16,17,18) |
| InChIKey | DWYPEKAJTHPXDD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|