C10H18IN5S — CID 111573035
2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-prop-2-enylguanidine;hydroiodide (PubChem CID 111573035) has the molecular formula C10H18IN5S and a molecular weight of 367.26 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111573035 |
| Molecular Formula | C10H18IN5S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(N)=N/Cc1csc(N(C)C)n1.I |
| InChI | InChI=1S/C10H17N5S.HI/c1-4-5-12-9(11)13-6-8-7-16-10(14-8)15(2)3;/h4,7H,1,5-6H2,2-3H3,(H3,11,12,13);1H |
| InChIKey | HPCNUZJSWXYYIT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|