C13H25N5S — CID 111964325
2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-(2-methylpropyl)guanidine (PubChem CID 111964325) has the molecular formula C13H25N5S and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-(2-methylpropyl)guanidine.
| Compound Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 111964325 |
| Molecular Formula | C13H25N5S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-(2-methylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1csc(N(C)C)n1)NCC(C)C |
| InChI | InChI=1S/C13H25N5S/c1-6-14-12(15-7-10(2)3)16-8-11-9-19-13(17-11)18(4)5/h9-10H,6-8H2,1-5H3,(H2,14,15,16) |
| InChIKey | STICDUSAWFFAGZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|