C17H24Cl2IN5OS — CID 109492627
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 109492627) has the molecular formula C17H24Cl2IN5OS and a molecular weight of 544.29 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109492627 |
| Molecular Formula | C17H24Cl2IN5OS |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(N(C)C)n1)NCC(O)c1cc(Cl)cc(Cl)c1.I |
| InChI | InChI=1S/C17H23Cl2N5OS.HI/c1-4-20-16(21-8-14-10-26-17(23-14)24(2)3)22-9-15(25)11-5-12(18)7-13(19)6-11;/h5-7,10,15,25H,4,8-9H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | YFINARGQUOUWCP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|