C16H23Cl2IN6O — CID 109492649
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 109492649) has the molecular formula C16H23Cl2IN6O and a molecular weight of 513.21 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109492649 |
| Molecular Formula | C16H23Cl2IN6O |
| Molecular Weight | 513.21 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)NCC(O)c1cc(Cl)cc(Cl)c1.I |
| InChI | InChI=1S/C16H22Cl2N6O.HI/c1-4-19-16(21-9-15-23-22-10(2)24(15)3)20-8-14(25)11-5-12(17)7-13(18)6-11;/h5-7,14,25H,4,8-9H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | SFZHCYRRFYBYNM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|