C22H26Cl2IN5O — CID 109492667
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109492667) has the molecular formula C22H26Cl2IN5O and a molecular weight of 574.29 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109492667 |
| Molecular Formula | C22H26Cl2IN5O |
| Molecular Weight | 574.29 g/mol |
| Exact Mass | 573.06 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccnc2)cc1)NCC(O)c1cc(Cl)cc(Cl)c1.I |
| InChI | InChI=1S/C22H25Cl2N5O.HI/c1-2-26-22(28-13-21(30)18-9-19(23)11-20(24)10-18)27-12-16-3-5-17(6-4-16)14-29-8-7-25-15-29;/h3-11,15,21,30H,2,12-14H2,1H3,(H2,26,27,28);1H |
| InChIKey | QWTYLBIUELCUGO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|