C18H23Cl2IN4O3S — CID 109492218
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 109492218) has the molecular formula C18H23Cl2IN4O3S and a molecular weight of 573.28 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109492218 |
| Molecular Formula | C18H23Cl2IN4O3S |
| Molecular Weight | 573.28 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCC(O)c1cc(Cl)cc(Cl)c1.I |
| InChI | InChI=1S/C18H22Cl2N4O3S.HI/c1-2-22-18(23-10-12-3-5-16(6-4-12)28(21,26)27)24-11-17(25)13-7-14(19)9-15(20)8-13;/h3-9,17,25H,2,10-11H2,1H3,(H2,21,26,27)(H2,22,23,24);1H |
| InChIKey | LAJVVNIQJSRLIR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|