C19H24Cl2IN3O3 — CID 109492614
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 109492614) has the molecular formula C19H24Cl2IN3O3 and a molecular weight of 540.23 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109492614 |
| Molecular Formula | C19H24Cl2IN3O3 |
| Molecular Weight | 540.23 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-[(2-hydroxy-5-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)ccc1O)NCC(O)c1cc(Cl)cc(Cl)c1.I |
| InChI | InChI=1S/C19H23Cl2N3O3.HI/c1-3-22-19(23-10-13-8-16(27-2)4-5-17(13)25)24-11-18(26)12-6-14(20)9-15(21)7-12;/h4-9,18,25-26H,3,10-11H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | QQWCMCWPRGDIML-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|