C19H24Cl2N4O2 — CID 109492726
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[(2-ethoxy-3-pyridinyl)methyl]-3-ethylguanidine (PubChem CID 109492726) has the molecular formula C19H24Cl2N4O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[(2-ethoxy-3-pyridinyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[(2-ethoxy-3-pyridinyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109492726 |
| Molecular Formula | C19H24Cl2N4O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-[(2-ethoxy-3-pyridinyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cccnc1OCC)NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H24Cl2N4O2/c1-3-22-19(24-11-13-6-5-7-23-18(13)27-4-2)25-12-17(26)14-8-15(20)10-16(21)9-14/h5-10,17,26H,3-4,11-12H2,1-2H3,(H2,22,24,25) |
| InChIKey | VYWUELMSLDCZFU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|