C15H19Cl2N5O — CID 109492429
1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 109492429) has the molecular formula C15H19Cl2N5O and a molecular weight of 356.26 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109492429 |
| Molecular Formula | C15H19Cl2N5O |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N5O/c1-2-18-15(19-8-13-3-4-21-22-13)20-9-14(23)10-5-11(16)7-12(17)6-10/h3-7,14,23H,2,8-9H2,1H3,(H,21,22)(H2,18,19,20) |
| InChIKey | ABHOMVYBKOHFTE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|