C15H21ClIN5S — CID 111372134
1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111372134) has the molecular formula C15H21ClIN5S and a molecular weight of 465.79 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111372134 |
| Molecular Formula | C15H21ClIN5S |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCCSc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C15H20ClN5S.HI/c1-2-17-15(19-11-13-7-8-20-21-13)18-9-10-22-14-5-3-12(16)4-6-14;/h3-8H,2,9-11H2,1H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | ODUOUBGHBOURPS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|