C20H23ClN6S — CID 111797072
1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111797072) has the molecular formula C20H23ClN6S and a molecular weight of 414.97 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111797072 |
| Molecular Formula | C20H23ClN6S |
| Molecular Weight | 414.97 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN6S/c1-2-22-20(23-10-11-28-18-8-6-17(21)7-9-18)24-13-15-4-3-5-16(12-15)19-25-14-26-27-19/h3-9,12,14H,2,10-11,13H2,1H3,(H2,22,23,24)(H,25,26,27) |
| InChIKey | NYAVXHNKKWOKFH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|