C20H33N7 — CID 111794585
1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111794585) has the molecular formula C20H33N7 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111794585 |
| Molecular Formula | C20H33N7 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C20H33N7/c1-6-21-20(22-10-11-27(15(2)3)16(4)5)23-13-17-8-7-9-18(12-17)19-24-14-25-26-19/h7-9,12,14-16H,6,10-11,13H2,1-5H3,(H2,21,22,23)(H,24,25,26) |
| InChIKey | JDQWJQMBVGNMCL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|