C24H33IN6O2 — CID 111794531
1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111794531) has the molecular formula C24H33IN6O2 and a molecular weight of 564.47 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111794531 |
| Molecular Formula | C24H33IN6O2 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NCCc1ccc(OCC)c(OCC)c1.I |
| InChI | InChI=1S/C24H32N6O2.HI/c1-4-25-24(27-16-19-8-7-9-20(14-19)23-28-17-29-30-23)26-13-12-18-10-11-21(31-5-2)22(15-18)32-6-3;/h7-11,14-15,17H,4-6,12-13,16H2,1-3H3,(H2,25,26,27)(H,28,29,30);1H |
| InChIKey | BJKDUMZCAQDWGE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|