C22H28N6O3 — CID 111797195
1-ethyl-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111797195) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-ethyl-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111797195 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-ethyl-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCc1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C22H28N6O3/c1-5-23-22(24-12-15-7-6-8-17(9-15)21-26-14-27-28-21)25-13-16-10-18(29-2)20(31-4)19(11-16)30-3/h6-11,14H,5,12-13H2,1-4H3,(H2,23,24,25)(H,26,27,28) |
| InChIKey | GVRKGQQGZANTMD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|