C22H23N7O — CID 111981277
1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111981277) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111981277 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H23N7O/c1-2-23-22(24-12-16-7-6-10-18(11-16)20-26-15-27-29-20)25-13-19-14-30-21(28-19)17-8-4-3-5-9-17/h3-11,14-15H,2,12-13H2,1H3,(H2,23,24,25)(H,26,27,29) |
| InChIKey | AFLYJTNCHOTPJJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|