C18H23IN6O — CID 111796548
1-ethyl-3-[2-(furan-2-yl)ethyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111796548) has the molecular formula C18H23IN6O and a molecular weight of 466.33 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111796548 |
| Molecular Formula | C18H23IN6O |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)ethyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NCCc1ccco1.I |
| InChI | InChI=1S/C18H22N6O.HI/c1-2-19-18(20-9-8-16-7-4-10-25-16)21-12-14-5-3-6-15(11-14)17-22-13-23-24-17;/h3-7,10-11,13H,2,8-9,12H2,1H3,(H2,19,20,21)(H,22,23,24);1H |
| InChIKey | VBFBXLOWEPRVPL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|