C20H24FIN6 — CID 111797609
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111797609) has the molecular formula C20H24FIN6 and a molecular weight of 494.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111797609 |
| Molecular Formula | C20H24FIN6 |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C20H23FN6.HI/c1-2-22-20(23-10-9-15-5-4-8-18(21)12-15)24-13-16-6-3-7-17(11-16)19-25-14-26-27-19;/h3-8,11-12,14H,2,9-10,13H2,1H3,(H2,22,23,24)(H,25,26,27);1H |
| InChIKey | WOUQHRJLCRPXSG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|