C18H21N7 — CID 111790346
1-ethyl-3-(pyridin-2-ylmethyl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111790346) has the molecular formula C18H21N7 and a molecular weight of 335.42 g/mol. Its IUPAC name is 1-ethyl-3-(pyridin-2-ylmethyl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(pyridin-2-ylmethyl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111790346 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-ethyl-3-(pyridin-2-ylmethyl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NCc1ccccn1 |
| InChI | InChI=1S/C18H21N7/c1-2-19-18(22-12-16-8-3-4-9-20-16)21-11-14-6-5-7-15(10-14)17-23-13-24-25-17/h3-10,13H,2,11-12H2,1H3,(H2,19,21,22)(H,23,24,25) |
| InChIKey | QQTZNOWDWPXDBJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|