C15H21FIN5 — CID 111395924
1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111395924) has the molecular formula C15H21FIN5 and a molecular weight of 417.27 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111395924 |
| Molecular Formula | C15H21FIN5 |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C15H20FN5.HI/c1-2-17-15(19-11-14-7-9-20-21-14)18-8-6-12-4-3-5-13(16)10-12;/h3-5,7,9-10H,2,6,8,11H2,1H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | FKURFSQCXHKESR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|