C19H29N5O2 — CID 111245969
1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111245969) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111245969 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C19H29N5O2/c1-4-20-19(22-14-16-10-12-23-24-16)21-11-9-15-7-8-17(25-5-2)18(13-15)26-6-3/h7-8,10,12-13H,4-6,9,11,14H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | BTMYCGMTFYJYLI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|