C16H23N5O2S — CID 111613412
1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111613412) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111613412 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H23N5O2S/c1-3-17-16(19-12-14-9-11-20-21-14)18-10-8-13-4-6-15(7-5-13)24(2,22)23/h4-7,9,11H,3,8,10,12H2,1-2H3,(H,20,21)(H2,17,18,19) |
| InChIKey | UDQCZYXNFJUODC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|