C16H23FIN5S — CID 111311109
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111311109) has the molecular formula C16H23FIN5S and a molecular weight of 463.36 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111311109 |
| Molecular Formula | C16H23FIN5S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCCCSc1ccc(F)cc1.I |
| InChI | InChI=1S/C16H22FN5S.HI/c1-2-18-16(20-12-14-8-10-21-22-14)19-9-3-11-23-15-6-4-13(17)5-7-15;/h4-8,10H,2-3,9,11-12H2,1H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | KQFSWPINFXUMPM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|