C20H28FN5S — CID 109402266
2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine (PubChem CID 109402266) has the molecular formula C20H28FN5S and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine.
| Compound Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine |
|---|---|
| PubChem CID | 109402266 |
| Molecular Formula | C20H28FN5S |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(N(C)C)n1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C20H28FN5S/c1-4-22-20(24-15-17-7-5-8-19(25-17)26(2)3)23-13-6-14-27-18-11-9-16(21)10-12-18/h5,7-12H,4,6,13-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | FADPZCROZZKQDG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|