C24H31IN4O2 — CID 111553264
1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111553264) has the molecular formula C24H31IN4O2 and a molecular weight of 534.44 g/mol. Its IUPAC name is 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553264 |
| Molecular Formula | C24H31IN4O2 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[3-(propan-2-yloxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(COC(C)C)c1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C24H30N4O2.HI/c1-4-25-24(26-14-19-9-8-10-20(13-19)16-29-18(2)3)27-15-22-17-30-23(28-22)21-11-6-5-7-12-21;/h5-13,17-18H,4,14-16H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | QDYLWKMRRCPRRC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|