C24H29N5O2 — CID 111552871
N-[4-[[[ethylamino-[(2-phenyl-1,3-oxazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylpropanamide (PubChem CID 111552871) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-[[[ethylamino-[(2-phenyl-1,3-oxazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[[ethylamino-[(2-phenyl-1,3-oxazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111552871 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[4-[[[ethylamino-[(2-phenyl-1,3-oxazol-4-yl)methylamino]methylidene]amino]methyl]phenyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)C(C)C)cc1)NCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H29N5O2/c1-4-25-24(26-14-18-10-12-20(13-11-18)28-22(30)17(2)3)27-15-21-16-31-23(29-21)19-8-6-5-7-9-19/h5-13,16-17H,4,14-15H2,1-3H3,(H,28,30)(H2,25,26,27) |
| InChIKey | YQARVOUICJXGJK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|